C11H27NO6P2 — CID 12557390
N,3-bis(diethoxyphosphoryl)propan-1-amine (PubChem CID 12557390) has the molecular formula C11H27NO6P2 and a molecular weight of 331.29 g/mol. Its IUPAC name is N,3-bis(diethoxyphosphoryl)propan-1-amine.
| Compound Name | N,3-bis(diethoxyphosphoryl)propan-1-amine |
|---|---|
| PubChem CID | 12557390 |
| Molecular Formula | C11H27NO6P2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N,3-bis(diethoxyphosphoryl)propan-1-amine |
| SMILES | CCOP(=O)(CCCNP(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C11H27NO6P2/c1-5-15-19(13,16-6-2)11-9-10-12-20(14,17-7-3)18-8-4/h5-11H2,1-4H3,(H,12,14) |
| InChIKey | RTVSFPOAMQNEAG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|