About 2-phenylselanylacetamide
2-phenylselanylacetamide (PubChem CID 12557564) has the molecular formula C8H9NOSe
and a molecular weight of 214.13 g/mol. Its IUPAC name is 2-phenylselanylacetamide.
Molecular Properties
| Compound Name | 2-phenylselanylacetamide |
| PubChem CID | 12557564 |
| Molecular Formula | C8H9NOSe |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 2-phenylselanylacetamide |
| SMILES | NC(=O)C[Se]c1ccccc1 |
| InChI | InChI=1S/C8H9NOSe/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | AUGSDUBBVSCHIS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylselanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylselanylacetamide?
The IUPAC name of 2-phenylselanylacetamide (CID 12557564) is 2-phenylselanylacetamide.
What is the SMILES notation for 2-phenylselanylacetamide?
The canonical SMILES for 2-phenylselanylacetamide is NC(=O)C[Se]c1ccccc1.
What is the InChIKey of 2-phenylselanylacetamide?
The InChIKey is AUGSDUBBVSCHIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOSe/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10).
What are the key properties of 2-phenylselanylacetamide?
2-phenylselanylacetamide has a molecular weight of 214.13 g/mol, XLogP of -0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylselanylacetamide is sourced from PubChem (CID 12557564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).