About N,N-diethyl-2,2-difluoroacetamide
N,N-diethyl-2,2-difluoroacetamide (PubChem CID 12557633) has the molecular formula C6H11F2NO
and a molecular weight of 151.16 g/mol. Its IUPAC name is N,N-diethyl-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N,N-diethyl-2,2-difluoroacetamide |
| PubChem CID | 12557633 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | N,N-diethyl-2,2-difluoroacetamide |
| SMILES | CCN(CC)C(=O)C(F)F |
| InChI | InChI=1S/C6H11F2NO/c1-3-9(4-2)6(10)5(7)8/h5H,3-4H2,1-2H3 |
| InChIKey | KRJKJVSLOIGMGA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,2-difluoroacetamide?
The IUPAC name of N,N-diethyl-2,2-difluoroacetamide (CID 12557633) is N,N-diethyl-2,2-difluoroacetamide.
What is the SMILES notation for N,N-diethyl-2,2-difluoroacetamide?
The canonical SMILES for N,N-diethyl-2,2-difluoroacetamide is CCN(CC)C(=O)C(F)F.
What is the InChIKey of N,N-diethyl-2,2-difluoroacetamide?
The InChIKey is KRJKJVSLOIGMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO/c1-3-9(4-2)6(10)5(7)8/h5H,3-4H2,1-2H3.
What are the key properties of N,N-diethyl-2,2-difluoroacetamide?
N,N-diethyl-2,2-difluoroacetamide has a molecular weight of 151.16 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,2-difluoroacetamide is sourced from PubChem (CID 12557633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).