About 2,6-dimethoxycyclohepta-2,4,6-trien-1-one
2,6-dimethoxycyclohepta-2,4,6-trien-1-one (PubChem CID 12557668) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,6-dimethoxycyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2,6-dimethoxycyclohepta-2,4,6-trien-1-one |
| PubChem CID | 12557668 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2,6-dimethoxycyclohepta-2,4,6-trien-1-one |
| SMILES | COc1cccc(OC)c(=O)c1 |
| InChI | InChI=1S/C9H10O3/c1-11-7-4-3-5-9(12-2)8(10)6-7/h3-6H,1-2H3 |
| InChIKey | SGSGPYIJPFRXKX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethoxycyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxycyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2,6-dimethoxycyclohepta-2,4,6-trien-1-one (CID 12557668) is 2,6-dimethoxycyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2,6-dimethoxycyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2,6-dimethoxycyclohepta-2,4,6-trien-1-one is COc1cccc(OC)c(=O)c1.
What is the InChIKey of 2,6-dimethoxycyclohepta-2,4,6-trien-1-one?
The InChIKey is SGSGPYIJPFRXKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-11-7-4-3-5-9(12-2)8(10)6-7/h3-6H,1-2H3.
What are the key properties of 2,6-dimethoxycyclohepta-2,4,6-trien-1-one?
2,6-dimethoxycyclohepta-2,4,6-trien-1-one has a molecular weight of 166.18 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxycyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 12557668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).