About 3-amino-2,4,5,6-tetrafluorophenol
3-amino-2,4,5,6-tetrafluorophenol (PubChem CID 12558020) has the molecular formula C6H3F4NO
and a molecular weight of 181.09 g/mol. Its IUPAC name is 3-amino-2,4,5,6-tetrafluorophenol.
Molecular Properties
| Compound Name | 3-amino-2,4,5,6-tetrafluorophenol |
| PubChem CID | 12558020 |
| Molecular Formula | C6H3F4NO |
| Molecular Weight | 181.09 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 3-amino-2,4,5,6-tetrafluorophenol |
| SMILES | Nc1c(F)c(O)c(F)c(F)c1F |
| InChI | InChI=1S/C6H3F4NO/c7-1-2(8)5(11)4(10)6(12)3(1)9/h12H,11H2 |
| InChIKey | VDWJBIGTNCXVHO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.09 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,4,5,6-tetrafluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4,5,6-tetrafluorophenol?
The IUPAC name of 3-amino-2,4,5,6-tetrafluorophenol (CID 12558020) is 3-amino-2,4,5,6-tetrafluorophenol.
What is the SMILES notation for 3-amino-2,4,5,6-tetrafluorophenol?
The canonical SMILES for 3-amino-2,4,5,6-tetrafluorophenol is Nc1c(F)c(O)c(F)c(F)c1F.
What is the InChIKey of 3-amino-2,4,5,6-tetrafluorophenol?
The InChIKey is VDWJBIGTNCXVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F4NO/c7-1-2(8)5(11)4(10)6(12)3(1)9/h12H,11H2.
What are the key properties of 3-amino-2,4,5,6-tetrafluorophenol?
3-amino-2,4,5,6-tetrafluorophenol has a molecular weight of 181.09 g/mol, XLogP of 1.53, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4,5,6-tetrafluorophenol is sourced from PubChem (CID 12558020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).