C12HF9O2 — CID 12558023
2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenoxy)phenol (PubChem CID 12558023) has the molecular formula C12HF9O2 and a molecular weight of 348.12 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenoxy)phenol.
| Compound Name | 2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenoxy)phenol |
|---|---|
| PubChem CID | 12558023 |
| Molecular Formula | C12HF9O2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenoxy)phenol |
| SMILES | Oc1c(F)c(F)c(F)c(Oc2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C12HF9O2/c13-1-2(14)6(18)11(7(19)3(1)15)23-12-8(20)4(16)5(17)10(22)9(12)21/h22H |
| InChIKey | NWZUHJOSHTXLHY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|