C14H14O5 — CID 12558255
4,9-dimethoxy-7,8-dihydrobenzo[f][1,3]benzodioxole-6-carbaldehyde (PubChem CID 12558255) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4,9-dimethoxy-7,8-dihydrobenzo[f][1,3]benzodioxole-6-carbaldehyde.
| Compound Name | 4,9-dimethoxy-7,8-dihydrobenzo[f][1,3]benzodioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 12558255 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4,9-dimethoxy-7,8-dihydrobenzo[f][1,3]benzodioxole-6-carbaldehyde |
| SMILES | COc1c2c(c(OC)c3c1OCO3)CCC(C=O)=C2 |
| InChI | InChI=1S/C14H14O5/c1-16-11-9-4-3-8(6-15)5-10(9)12(17-2)14-13(11)18-7-19-14/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | UNEIYWKSVDTBQX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|