About 4,9-dimethoxybenzo[f][1,3]benzodioxole
4,9-dimethoxybenzo[f][1,3]benzodioxole (PubChem CID 12558262) has the molecular formula C13H12O4
and a molecular weight of 232.23 g/mol. Its IUPAC name is 4,9-dimethoxybenzo[f][1,3]benzodioxole.
Molecular Properties
| Compound Name | 4,9-dimethoxybenzo[f][1,3]benzodioxole |
| PubChem CID | 12558262 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4,9-dimethoxybenzo[f][1,3]benzodioxole |
| SMILES | COc1c2c(c(OC)c3ccccc13)OCO2 |
| InChI | InChI=1S/C13H12O4/c1-14-10-8-5-3-4-6-9(8)11(15-2)13-12(10)16-7-17-13/h3-6H,7H2,1-2H3 |
| InChIKey | TYUZNCUSMBTHNZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,9-dimethoxybenzo[f][1,3]benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethoxybenzo[f][1,3]benzodioxole?
The IUPAC name of 4,9-dimethoxybenzo[f][1,3]benzodioxole (CID 12558262) is 4,9-dimethoxybenzo[f][1,3]benzodioxole.
What is the SMILES notation for 4,9-dimethoxybenzo[f][1,3]benzodioxole?
The canonical SMILES for 4,9-dimethoxybenzo[f][1,3]benzodioxole is COc1c2c(c(OC)c3ccccc13)OCO2.
What is the InChIKey of 4,9-dimethoxybenzo[f][1,3]benzodioxole?
The InChIKey is TYUZNCUSMBTHNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4/c1-14-10-8-5-3-4-6-9(8)11(15-2)13-12(10)16-7-17-13/h3-6H,7H2,1-2H3.
What are the key properties of 4,9-dimethoxybenzo[f][1,3]benzodioxole?
4,9-dimethoxybenzo[f][1,3]benzodioxole has a molecular weight of 232.23 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethoxybenzo[f][1,3]benzodioxole is sourced from PubChem (CID 12558262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).