C20H17Cl2N3O4S — CID 1255827
3-(2,6-dichlorophenyl)-N-[(2,5-dimethoxyphenyl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 1255827) has the molecular formula C20H17Cl2N3O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[(2,5-dimethoxyphenyl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[(2,5-dimethoxyphenyl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 1255827 |
| Molecular Formula | C20H17Cl2N3O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[(2,5-dimethoxyphenyl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=S)NC(=O)c2c(-c3c(Cl)cccc3Cl)noc2C)c1 |
| InChI | InChI=1S/C20H17Cl2N3O4S/c1-10-16(18(25-29-10)17-12(21)5-4-6-13(17)22)19(26)24-20(30)23-14-9-11(27-2)7-8-15(14)28-3/h4-9H,1-3H3,(H2,23,24,26,30) |
| InChIKey | YBPJPOAIEQTQSW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|