About 3-propyl-1,3-benzothiazole-2-thione
3-propyl-1,3-benzothiazole-2-thione (PubChem CID 12558451) has the molecular formula C10H11NS2
and a molecular weight of 209.34 g/mol. Its IUPAC name is 3-propyl-1,3-benzothiazole-2-thione.
Molecular Properties
| Compound Name | 3-propyl-1,3-benzothiazole-2-thione |
| PubChem CID | 12558451 |
| Molecular Formula | C10H11NS2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 3-propyl-1,3-benzothiazole-2-thione |
| SMILES | CCCn1c(=S)sc2ccccc21 |
| InChI | InChI=1S/C10H11NS2/c1-2-7-11-8-5-3-4-6-9(8)13-10(11)12/h3-6H,2,7H2,1H3 |
| InChIKey | BHKQRONBQWEYJB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-propyl-1,3-benzothiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1,3-benzothiazole-2-thione?
The IUPAC name of 3-propyl-1,3-benzothiazole-2-thione (CID 12558451) is 3-propyl-1,3-benzothiazole-2-thione.
What is the SMILES notation for 3-propyl-1,3-benzothiazole-2-thione?
The canonical SMILES for 3-propyl-1,3-benzothiazole-2-thione is CCCn1c(=S)sc2ccccc21.
What is the InChIKey of 3-propyl-1,3-benzothiazole-2-thione?
The InChIKey is BHKQRONBQWEYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS2/c1-2-7-11-8-5-3-4-6-9(8)13-10(11)12/h3-6H,2,7H2,1H3.
What are the key properties of 3-propyl-1,3-benzothiazole-2-thione?
3-propyl-1,3-benzothiazole-2-thione has a molecular weight of 209.34 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1,3-benzothiazole-2-thione is sourced from PubChem (CID 12558451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).