About methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate
methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate (PubChem CID 12559216) has the molecular formula C10H13Cl3N2O4
and a molecular weight of 331.58 g/mol. Its IUPAC name is methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate |
| PubChem CID | 12559216 |
| Molecular Formula | C10H13Cl3N2O4 |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate |
| SMILES | COC(=O)/C=C(C)/N=N/C(=O)OC(C)(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13Cl3N2O4/c1-6(5-7(16)18-4)14-15-8(17)19-9(2,3)10(11,12)13/h5H,1-4H3/b6-5+,15-14+ |
| InChIKey | XVMCZINFZPBESF-HBLIKVQQSA-N |
| XLogP | 3.80 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate?
The IUPAC name of methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate (CID 12559216) is methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate.
What is the SMILES notation for methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate?
The canonical SMILES for methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate is COC(=O)/C=C(C)/N=N/C(=O)OC(C)(C)C(Cl)(Cl)Cl.
What is the InChIKey of methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate?
The InChIKey is XVMCZINFZPBESF-HBLIKVQQSA-N. The full InChI is InChI=1S/C10H13Cl3N2O4/c1-6(5-7(16)18-4)14-15-8(17)19-9(2,3)10(11,12)13/h5H,1-4H3/b6-5+,15-14+.
What are the key properties of methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate?
methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate has a molecular weight of 331.58 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate is sourced from PubChem (CID 12559216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).