C18H16FIN4OS — CID 1256002
2-[[4-ethyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide (PubChem CID 1256002) has the molecular formula C18H16FIN4OS and a molecular weight of 482.32 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 1256002 |
| Molecular Formula | C18H16FIN4OS |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 2-[[4-ethyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc(I)cc2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C18H16FIN4OS/c1-2-24-17(14-5-3-4-6-15(14)19)22-23-18(24)26-11-16(25)21-13-9-7-12(20)8-10-13/h3-10H,2,11H2,1H3,(H,21,25) |
| InChIKey | ALROVVHSABXJIV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|