C19H15F6NO3S — CID 12560297
2-benzamido-2-benzylsulfanyl-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid (PubChem CID 12560297) has the molecular formula C19H15F6NO3S and a molecular weight of 451.39 g/mol. Its IUPAC name is 2-benzamido-2-benzylsulfanyl-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid.
| Compound Name | 2-benzamido-2-benzylsulfanyl-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 12560297 |
| Molecular Formula | C19H15F6NO3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2-benzamido-2-benzylsulfanyl-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
| SMILES | O=C(NC(SCc1ccccc1)(C(=O)O)C(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H15F6NO3S/c20-18(21,22)15(19(23,24)25)17(16(28)29,30-11-12-7-3-1-4-8-12)26-14(27)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,26,27)(H,28,29) |
| InChIKey | MWMOOMACNNULOA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|