C4H3FN2O3 — CID 12560505
5-fluoro-1,3-diazinane-2,4,6-trione (PubChem CID 12560505) has the molecular formula C4H3FN2O3 and a molecular weight of 146.08 g/mol. Its IUPAC name is 5-fluoro-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-fluoro-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12560505 |
| Molecular Formula | C4H3FN2O3 |
| Molecular Weight | 146.08 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | 5-fluoro-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(F)C(=O)N1 |
| InChI | InChI=1S/C4H3FN2O3/c5-1-2(8)6-4(10)7-3(1)9/h1H,(H2,6,7,8,9,10) |
| InChIKey | HSLXWCNTARBVLS-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.08 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|