About 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol
4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol (PubChem CID 12561013) has the molecular formula C26H26N4O2
and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol |
| PubChem CID | 12561013 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol |
| SMILES | Oc1ccc(C(NNc2ccccc2)C(NNc2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c31-23-15-11-19(12-16-23)25(29-27-21-7-3-1-4-8-21)26(20-13-17-24(32)18-14-20)30-28-22-9-5-2-6-10-22/h1-18,25-32H |
| InChIKey | CTLQTPGEOVCDQY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol?
The IUPAC name of 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol (CID 12561013) is 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol.
What is the SMILES notation for 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol?
The canonical SMILES for 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol is Oc1ccc(C(NNc2ccccc2)C(NNc2ccccc2)c2ccc(O)cc2)cc1.
What is the InChIKey of 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol?
The InChIKey is CTLQTPGEOVCDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O2/c31-23-15-11-19(12-16-23)25(29-27-21-7-3-1-4-8-21)26(20-13-17-24(32)18-14-20)30-28-22-9-5-2-6-10-22/h1-18,25-32H.
What are the key properties of 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol?
4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol has a molecular weight of 426.52 g/mol, XLogP of 5.11, 9 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-hydroxyphenyl)-1,2-bis(2-phenylhydrazinyl)ethyl]phenol is sourced from PubChem (CID 12561013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).