C16H13NO2S2 — CID 12561043
S-benzyl 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethioate (PubChem CID 12561043) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is S-benzyl 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethioate.
| Compound Name | S-benzyl 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethioate |
|---|---|
| PubChem CID | 12561043 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | S-benzyl 2-(2-oxo-1,3-benzothiazol-3-yl)ethanethioate |
| SMILES | O=C(Cn1c(=O)sc2ccccc21)SCc1ccccc1 |
| InChI | InChI=1S/C16H13NO2S2/c18-15(20-11-12-6-2-1-3-7-12)10-17-13-8-4-5-9-14(13)21-16(17)19/h1-9H,10-11H2 |
| InChIKey | DOESQGXHLGEZMY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|