C20H50Si5 — CID 12561631
1,1,2,2,3,3,4,4,5,5-decaethylpentasilolane (PubChem CID 12561631) has the molecular formula C20H50Si5 and a molecular weight of 431.05 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decaethylpentasilolane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decaethylpentasilolane |
|---|---|
| PubChem CID | 12561631 |
| Molecular Formula | C20H50Si5 |
| Molecular Weight | 431.05 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decaethylpentasilolane |
| SMILES | CC[Si]1(CC)[Si](CC)(CC)[Si](CC)(CC)[Si](CC)(CC)[Si]1(CC)CC |
| InChI | InChI=1S/C20H50Si5/c1-11-21(12-2)22(13-3,14-4)24(17-7,18-8)25(19-9,20-10)23(21,15-5)16-6/h11-20H2,1-10H3 |
| InChIKey | NGAHYNFGNNHRHK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.05 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|