About 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol
4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol (PubChem CID 12561670) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol |
| PubChem CID | 12561670 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol |
| SMILES | CC[C@H](C1CCC(O)CC1)[C@@H](CC)C1CCC(O)CC1 |
| InChI | InChI=1S/C18H34O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h13-20H,3-12H2,1-2H3/t13?,14?,15?,16?,17-,18+ |
| InChIKey | WEWXCETUQCZGAO-OJXIMMSJSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol?
The IUPAC name of 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol (CID 12561670) is 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol.
What is the SMILES notation for 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol?
The canonical SMILES for 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol is CC[C@H](C1CCC(O)CC1)[C@@H](CC)C1CCC(O)CC1.
What is the InChIKey of 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol?
The InChIKey is WEWXCETUQCZGAO-OJXIMMSJSA-N. The full InChI is InChI=1S/C18H34O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h13-20H,3-12H2,1-2H3/t13?,14?,15?,16?,17-,18+.
What are the key properties of 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol?
4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol has a molecular weight of 282.47 g/mol, XLogP of 4.14, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,4S)-4-(4-hydroxycyclohexyl)hexan-3-yl]cyclohexan-1-ol is sourced from PubChem (CID 12561670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).