About S-benzyl 2-methylpropanethioate
S-benzyl 2-methylpropanethioate (PubChem CID 12561691) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is S-benzyl 2-methylpropanethioate.
Molecular Properties
| Compound Name | S-benzyl 2-methylpropanethioate |
| PubChem CID | 12561691 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | S-benzyl 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C11H14OS/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | KYJFJIMIPKSVRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzyl 2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzyl 2-methylpropanethioate?
The IUPAC name of S-benzyl 2-methylpropanethioate (CID 12561691) is S-benzyl 2-methylpropanethioate.
What is the SMILES notation for S-benzyl 2-methylpropanethioate?
The canonical SMILES for S-benzyl 2-methylpropanethioate is CC(C)C(=O)SCc1ccccc1.
What is the InChIKey of S-benzyl 2-methylpropanethioate?
The InChIKey is KYJFJIMIPKSVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3.
What are the key properties of S-benzyl 2-methylpropanethioate?
S-benzyl 2-methylpropanethioate has a molecular weight of 194.30 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzyl 2-methylpropanethioate is sourced from PubChem (CID 12561691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).