C6H7Cl7 — CID 12561804
1,1,1,5-tetrachloro-2-(trichloromethyl)pentane (PubChem CID 12561804) has the molecular formula C6H7Cl7 and a molecular weight of 327.29 g/mol. Its IUPAC name is 1,1,1,5-tetrachloro-2-(trichloromethyl)pentane.
| Compound Name | 1,1,1,5-tetrachloro-2-(trichloromethyl)pentane |
|---|---|
| PubChem CID | 12561804 |
| Molecular Formula | C6H7Cl7 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 323.84 |
| IUPAC Name | 1,1,1,5-tetrachloro-2-(trichloromethyl)pentane |
| SMILES | ClCCCC(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H7Cl7/c7-3-1-2-4(5(8,9)10)6(11,12)13/h4H,1-3H2 |
| InChIKey | BWTSDGMFYKCWDV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|