About 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine
2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine (PubChem CID 12562263) has the molecular formula C11H11ClO2
and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine |
| PubChem CID | 12562263 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine |
| SMILES | Clc1ccc(C2OCC=CCO2)cc1 |
| InChI | InChI=1S/C11H11ClO2/c12-10-5-3-9(4-6-10)11-13-7-1-2-8-14-11/h1-6,11H,7-8H2 |
| InChIKey | LOXOJCXYKAMRFQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine?
The IUPAC name of 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine (CID 12562263) is 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine.
What is the SMILES notation for 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine?
The canonical SMILES for 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine is Clc1ccc(C2OCC=CCO2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine?
The InChIKey is LOXOJCXYKAMRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO2/c12-10-5-3-9(4-6-10)11-13-7-1-2-8-14-11/h1-6,11H,7-8H2.
What are the key properties of 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine?
2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine has a molecular weight of 210.66 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4,7-dihydro-1,3-dioxepine is sourced from PubChem (CID 12562263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).