About 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate
1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate (PubChem CID 12562302) has the molecular formula C17H17N3O4S
and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate |
| PubChem CID | 12562302 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)Cn2nnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C17H17N3O4S/c1-12-7-9-14(10-8-12)25(22,23)24-13(2)11-20-17(21)15-5-3-4-6-16(15)18-19-20/h3-10,13H,11H2,1-2H3 |
| InChIKey | PKTZYRUTUYUDKT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate?
The IUPAC name of 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate (CID 12562302) is 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate.
What is the SMILES notation for 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate?
The canonical SMILES for 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC(C)Cn2nnc3ccccc3c2=O)cc1.
What is the InChIKey of 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate?
The InChIKey is PKTZYRUTUYUDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O4S/c1-12-7-9-14(10-8-12)25(22,23)24-13(2)11-20-17(21)15-5-3-4-6-16(15)18-19-20/h3-10,13H,11H2,1-2H3.
What are the key properties of 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate?
1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate has a molecular weight of 359.41 g/mol, XLogP of 1.89, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-oxo-1,2,3-benzotriazin-3-yl)propan-2-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 12562302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).