About 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide
2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 12562481) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 12562481 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CN(C)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H11N3OS/c1-10(2)5-6(11)9-7-8-3-4-12-7/h3-4H,5H2,1-2H3,(H,8,9,11) |
| InChIKey | GQOFDBYYFWTNOV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide (CID 12562481) is 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide is CN(C)CC(=O)Nc1nccs1.
What is the InChIKey of 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is GQOFDBYYFWTNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c1-10(2)5-6(11)9-7-8-3-4-12-7/h3-4H,5H2,1-2H3,(H,8,9,11).
What are the key properties of 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide?
2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 185.25 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 12562481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).