About 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine
3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine (PubChem CID 12562837) has the molecular formula C11H13ClN4
and a molecular weight of 236.71 g/mol. Its IUPAC name is 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine |
| PubChem CID | 12562837 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine |
| SMILES | CCc1c(C)nn(-c2ccc(Cl)nn2)c1C |
| InChI | InChI=1S/C11H13ClN4/c1-4-9-7(2)15-16(8(9)3)11-6-5-10(12)13-14-11/h5-6H,4H2,1-3H3 |
| InChIKey | NZEYPAXAQSCGHD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine?
The IUPAC name of 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine (CID 12562837) is 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine.
What is the SMILES notation for 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine?
The canonical SMILES for 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine is CCc1c(C)nn(-c2ccc(Cl)nn2)c1C.
What is the InChIKey of 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine?
The InChIKey is NZEYPAXAQSCGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4/c1-4-9-7(2)15-16(8(9)3)11-6-5-10(12)13-14-11/h5-6H,4H2,1-3H3.
What are the key properties of 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine?
3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine has a molecular weight of 236.71 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridazine is sourced from PubChem (CID 12562837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).