About [1,3]dioxolo[4,5-b]pyridine
[1,3]dioxolo[4,5-b]pyridine (PubChem CID 12563079) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | [1,3]dioxolo[4,5-b]pyridine |
| PubChem CID | 12563079 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | [1,3]dioxolo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)OCO2 |
| InChI | InChI=1S/C6H5NO2/c1-2-5-6(7-3-1)9-4-8-5/h1-3H,4H2 |
| InChIKey | YIIOTOBXQVQGSV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,3]dioxolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]dioxolo[4,5-b]pyridine?
The IUPAC name of [1,3]dioxolo[4,5-b]pyridine (CID 12563079) is [1,3]dioxolo[4,5-b]pyridine.
What is the SMILES notation for [1,3]dioxolo[4,5-b]pyridine?
The canonical SMILES for [1,3]dioxolo[4,5-b]pyridine is c1cnc2c(c1)OCO2.
What is the InChIKey of [1,3]dioxolo[4,5-b]pyridine?
The InChIKey is YIIOTOBXQVQGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2/c1-2-5-6(7-3-1)9-4-8-5/h1-3H,4H2.
What are the key properties of [1,3]dioxolo[4,5-b]pyridine?
[1,3]dioxolo[4,5-b]pyridine has a molecular weight of 123.11 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]dioxolo[4,5-b]pyridine is sourced from PubChem (CID 12563079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).