About 4-sulfanylbenzene-1,3-diol
4-sulfanylbenzene-1,3-diol (PubChem CID 12563346) has the molecular formula C6H6O2S
and a molecular weight of 142.18 g/mol. Its IUPAC name is 4-sulfanylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 4-sulfanylbenzene-1,3-diol |
| PubChem CID | 12563346 |
| Molecular Formula | C6H6O2S |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | 4-sulfanylbenzene-1,3-diol |
| SMILES | Oc1ccc(S)c(O)c1 |
| InChI | InChI=1S/C6H6O2S/c7-4-1-2-6(9)5(8)3-4/h1-3,7-9H |
| InChIKey | XFTQIEMOLHJTFV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylbenzene-1,3-diol?
The IUPAC name of 4-sulfanylbenzene-1,3-diol (CID 12563346) is 4-sulfanylbenzene-1,3-diol.
What is the SMILES notation for 4-sulfanylbenzene-1,3-diol?
The canonical SMILES for 4-sulfanylbenzene-1,3-diol is Oc1ccc(S)c(O)c1.
What is the InChIKey of 4-sulfanylbenzene-1,3-diol?
The InChIKey is XFTQIEMOLHJTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S/c7-4-1-2-6(9)5(8)3-4/h1-3,7-9H.
What are the key properties of 4-sulfanylbenzene-1,3-diol?
4-sulfanylbenzene-1,3-diol has a molecular weight of 142.18 g/mol, XLogP of 1.39, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylbenzene-1,3-diol is sourced from PubChem (CID 12563346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).