About dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate
dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 12563480) has the molecular formula C14H22O4Si
and a molecular weight of 282.41 g/mol. Its IUPAC name is dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate |
| PubChem CID | 12563480 |
| Molecular Formula | C14H22O4Si |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(C[Si](C)(C)C)=CC1 |
| InChI | InChI=1S/C14H22O4Si/c1-17-13(15)11-7-6-10(9-19(3,4)5)8-12(11)14(16)18-2/h6H,7-9H2,1-5H3 |
| InChIKey | HLMZQSCVLSAHAU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate?
The IUPAC name of dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate (CID 12563480) is dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate is COC(=O)C1=C(C(=O)OC)CC(C[Si](C)(C)C)=CC1.
What is the InChIKey of dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate?
The InChIKey is HLMZQSCVLSAHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4Si/c1-17-13(15)11-7-6-10(9-19(3,4)5)8-12(11)14(16)18-2/h6H,7-9H2,1-5H3.
What are the key properties of dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate?
dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate has a molecular weight of 282.41 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-(trimethylsilylmethyl)cyclohexa-1,4-diene-1,2-dicarboxylate is sourced from PubChem (CID 12563480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).