C9F16 — CID 12563819
1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexene (PubChem CID 12563819) has the molecular formula C9F16 and a molecular weight of 412.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 12563819 |
| Molecular Formula | C9F16 |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexene |
| SMILES | FC1=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9F16/c10-2-1(3(11,8(20,21)22)9(23,24)25)4(12,13)6(16,17)7(18,19)5(2,14)15 |
| InChIKey | QQHICBRRDDGPEA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|