C11H13BrO3 — CID 12564098
8-bromo-3,3,8-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-2-one (PubChem CID 12564098) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 8-bromo-3,3,8-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-2-one.
| Compound Name | 8-bromo-3,3,8-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-2-one |
|---|---|
| PubChem CID | 12564098 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 8-bromo-3,3,8-trimethyl-1,4-dioxaspiro[4.5]deca-6,9-dien-2-one |
| SMILES | CC1(Br)C=CC2(C=C1)OC(=O)C(C)(C)O2 |
| InChI | InChI=1S/C11H13BrO3/c1-9(2)8(13)14-11(15-9)6-4-10(3,12)5-7-11/h4-7H,1-3H3 |
| InChIKey | WGKLYYZSWAAZHU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|