About 7-methoxy-2-methylhept-1-en-3,6-diyne
7-methoxy-2-methylhept-1-en-3,6-diyne (PubChem CID 12564143) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 7-methoxy-2-methylhept-1-en-3,6-diyne.
Molecular Properties
| Compound Name | 7-methoxy-2-methylhept-1-en-3,6-diyne |
| PubChem CID | 12564143 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 7-methoxy-2-methylhept-1-en-3,6-diyne |
| SMILES | C=C(C)C#CCC#COC |
| InChI | InChI=1S/C9H10O/c1-9(2)7-5-4-6-8-10-3/h1,4H2,2-3H3 |
| InChIKey | FQJVGDOPJQVZRL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-2-methylhept-1-en-3,6-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2-methylhept-1-en-3,6-diyne?
The IUPAC name of 7-methoxy-2-methylhept-1-en-3,6-diyne (CID 12564143) is 7-methoxy-2-methylhept-1-en-3,6-diyne.
What is the SMILES notation for 7-methoxy-2-methylhept-1-en-3,6-diyne?
The canonical SMILES for 7-methoxy-2-methylhept-1-en-3,6-diyne is C=C(C)C#CCC#COC.
What is the InChIKey of 7-methoxy-2-methylhept-1-en-3,6-diyne?
The InChIKey is FQJVGDOPJQVZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-9(2)7-5-4-6-8-10-3/h1,4H2,2-3H3.
What are the key properties of 7-methoxy-2-methylhept-1-en-3,6-diyne?
7-methoxy-2-methylhept-1-en-3,6-diyne has a molecular weight of 134.18 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2-methylhept-1-en-3,6-diyne is sourced from PubChem (CID 12564143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).