About 6,7-dimethoxy-2,2-dimethylchromene
6,7-dimethoxy-2,2-dimethylchromene (PubChem CID 12565) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 6,7-dimethoxy-2,2-dimethylchromene.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2,2-dimethylchromene |
| PubChem CID | 12565 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6,7-dimethoxy-2,2-dimethylchromene |
| SMILES | COc1cc2c(cc1OC)OC(C)(C)C=C2 |
| InChI | InChI=1S/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3 |
| InChIKey | PTIDGSWTMLSGAH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethoxy-2,2-dimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2,2-dimethylchromene?
The IUPAC name of 6,7-dimethoxy-2,2-dimethylchromene (CID 12565) is 6,7-dimethoxy-2,2-dimethylchromene.
What is the SMILES notation for 6,7-dimethoxy-2,2-dimethylchromene?
The canonical SMILES for 6,7-dimethoxy-2,2-dimethylchromene is COc1cc2c(cc1OC)OC(C)(C)C=C2.
What is the InChIKey of 6,7-dimethoxy-2,2-dimethylchromene?
The InChIKey is PTIDGSWTMLSGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3.
What are the key properties of 6,7-dimethoxy-2,2-dimethylchromene?
6,7-dimethoxy-2,2-dimethylchromene has a molecular weight of 220.27 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2,2-dimethylchromene is sourced from PubChem (CID 12565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).