About 1-cyclopenta-1,3-dien-1-ylcyclohexene
1-cyclopenta-1,3-dien-1-ylcyclohexene (PubChem CID 12565000) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclohexene.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclohexene |
| PubChem CID | 12565000 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclohexene |
| SMILES | C1=CCC(C2=CCCCC2)=C1 |
| InChI | InChI=1S/C11H14/c1-2-6-10(7-3-1)11-8-4-5-9-11/h4-6,8H,1-3,7,9H2 |
| InChIKey | GDVVRMMGCJTGKW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclopenta-1,3-dien-1-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclohexene?
The IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclohexene (CID 12565000) is 1-cyclopenta-1,3-dien-1-ylcyclohexene.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-ylcyclohexene?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-ylcyclohexene is C1=CCC(C2=CCCCC2)=C1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-ylcyclohexene?
The InChIKey is GDVVRMMGCJTGKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14/c1-2-6-10(7-3-1)11-8-4-5-9-11/h4-6,8H,1-3,7,9H2.
What are the key properties of 1-cyclopenta-1,3-dien-1-ylcyclohexene?
1-cyclopenta-1,3-dien-1-ylcyclohexene has a molecular weight of 146.23 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-ylcyclohexene is sourced from PubChem (CID 12565000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).