C16H20O9 — CID 12565144
[(1S,4R,5S,6R)-5,6-diacetyloxy-3-(acetyloxymethyl)-7-oxabicyclo[2.2.1]hept-2-en-2-yl]methyl acetate (PubChem CID 12565144) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is [(1S,4R,5S,6R)-5,6-diacetyloxy-3-(acetyloxymethyl)-7-oxabicyclo[2.2.1]hept-2-en-2-yl]methyl acetate.
| Compound Name | [(1S,4R,5S,6R)-5,6-diacetyloxy-3-(acetyloxymethyl)-7-oxabicyclo[2.2.1]hept-2-en-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12565144 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [(1S,4R,5S,6R)-5,6-diacetyloxy-3-(acetyloxymethyl)-7-oxabicyclo[2.2.1]hept-2-en-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(COC(C)=O)[C@@H]2O[C@H]1[C@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C16H20O9/c1-7(17)21-5-11-12(6-22-8(2)18)14-16(24-10(4)20)15(13(11)25-14)23-9(3)19/h13-16H,5-6H2,1-4H3/t13-,14+,15+,16- |
| InChIKey | TWKWAKDBYKUGBZ-SYMSYNOKSA-N |
| XLogP | 0.05 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|