About 1-ethyl-4-nitropyrazole
1-ethyl-4-nitropyrazole (PubChem CID 12565213) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 1-ethyl-4-nitropyrazole.
Molecular Properties
| Compound Name | 1-ethyl-4-nitropyrazole |
| PubChem CID | 12565213 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 1-ethyl-4-nitropyrazole |
| SMILES | CCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C5H7N3O2/c1-2-7-4-5(3-6-7)8(9)10/h3-4H,2H2,1H3 |
| InChIKey | LQPXKEBIYOXPKM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-nitropyrazole?
The IUPAC name of 1-ethyl-4-nitropyrazole (CID 12565213) is 1-ethyl-4-nitropyrazole.
What is the SMILES notation for 1-ethyl-4-nitropyrazole?
The canonical SMILES for 1-ethyl-4-nitropyrazole is CCn1cc([N+](=O)[O-])cn1.
What is the InChIKey of 1-ethyl-4-nitropyrazole?
The InChIKey is LQPXKEBIYOXPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-2-7-4-5(3-6-7)8(9)10/h3-4H,2H2,1H3.
What are the key properties of 1-ethyl-4-nitropyrazole?
1-ethyl-4-nitropyrazole has a molecular weight of 141.13 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-nitropyrazole is sourced from PubChem (CID 12565213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).