About 2,7-dipropylpyrrolo[1,2-b]pyridazine
2,7-dipropylpyrrolo[1,2-b]pyridazine (PubChem CID 12565817) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,7-dipropylpyrrolo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2,7-dipropylpyrrolo[1,2-b]pyridazine |
| PubChem CID | 12565817 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2,7-dipropylpyrrolo[1,2-b]pyridazine |
| SMILES | CCCc1ccc2ccc(CCC)n2n1 |
| InChI | InChI=1S/C13H18N2/c1-3-5-11-7-8-13-10-9-12(6-4-2)15(13)14-11/h7-10H,3-6H2,1-2H3 |
| InChIKey | SJYYVOVQBORQQL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dipropylpyrrolo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dipropylpyrrolo[1,2-b]pyridazine?
The IUPAC name of 2,7-dipropylpyrrolo[1,2-b]pyridazine (CID 12565817) is 2,7-dipropylpyrrolo[1,2-b]pyridazine.
What is the SMILES notation for 2,7-dipropylpyrrolo[1,2-b]pyridazine?
The canonical SMILES for 2,7-dipropylpyrrolo[1,2-b]pyridazine is CCCc1ccc2ccc(CCC)n2n1.
What is the InChIKey of 2,7-dipropylpyrrolo[1,2-b]pyridazine?
The InChIKey is SJYYVOVQBORQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-3-5-11-7-8-13-10-9-12(6-4-2)15(13)14-11/h7-10H,3-6H2,1-2H3.
What are the key properties of 2,7-dipropylpyrrolo[1,2-b]pyridazine?
2,7-dipropylpyrrolo[1,2-b]pyridazine has a molecular weight of 202.30 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dipropylpyrrolo[1,2-b]pyridazine is sourced from PubChem (CID 12565817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).