C6H8N2O — CID 12565999
3,6-dimethyl-1H-pyrazin-2-one (PubChem CID 12565999) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 3,6-dimethyl-1H-pyrazin-2-one.
| Compound Name | 3,6-dimethyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 12565999 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 3,6-dimethyl-1H-pyrazin-2-one |
| SMILES | Cc1cnc(C)c(=O)[nH]1 |
| InChI | InChI=1S/C6H8N2O/c1-4-3-7-5(2)6(9)8-4/h3H,1-2H3,(H,8,9) |
| InChIKey | IUNWZLUSFPXBIJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |