C19H19N — CID 12566036
17-methyl-17-azatetracyclo[12.5.0.02,7.08,13]nonadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 12566036) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 17-methyl-17-azatetracyclo[12.5.0.02,7.08,13]nonadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | 17-methyl-17-azatetracyclo[12.5.0.02,7.08,13]nonadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 12566036 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 17-methyl-17-azatetracyclo[12.5.0.02,7.08,13]nonadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | CN1CCc2c(c3ccccc3c3ccccc23)CC1 |
| InChI | InChI=1S/C19H19N/c1-20-12-10-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)19(18)11-13-20/h2-9H,10-13H2,1H3 |
| InChIKey | FWWVJHNCRWJMAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|