About 4-butyl-2,3,5,6-tetrafluoroaniline
4-butyl-2,3,5,6-tetrafluoroaniline (PubChem CID 12566451) has the molecular formula C10H11F4N
and a molecular weight of 221.20 g/mol. Its IUPAC name is 4-butyl-2,3,5,6-tetrafluoroaniline.
Molecular Properties
| Compound Name | 4-butyl-2,3,5,6-tetrafluoroaniline |
| PubChem CID | 12566451 |
| Molecular Formula | C10H11F4N |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-butyl-2,3,5,6-tetrafluoroaniline |
| SMILES | CCCCc1c(F)c(F)c(N)c(F)c1F |
| InChI | InChI=1S/C10H11F4N/c1-2-3-4-5-6(11)8(13)10(15)9(14)7(5)12/h2-4,15H2,1H3 |
| InChIKey | KONUOOZGCACSMW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2,3,5,6-tetrafluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2,3,5,6-tetrafluoroaniline?
The IUPAC name of 4-butyl-2,3,5,6-tetrafluoroaniline (CID 12566451) is 4-butyl-2,3,5,6-tetrafluoroaniline.
What is the SMILES notation for 4-butyl-2,3,5,6-tetrafluoroaniline?
The canonical SMILES for 4-butyl-2,3,5,6-tetrafluoroaniline is CCCCc1c(F)c(F)c(N)c(F)c1F.
What is the InChIKey of 4-butyl-2,3,5,6-tetrafluoroaniline?
The InChIKey is KONUOOZGCACSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F4N/c1-2-3-4-5-6(11)8(13)10(15)9(14)7(5)12/h2-4,15H2,1H3.
What are the key properties of 4-butyl-2,3,5,6-tetrafluoroaniline?
4-butyl-2,3,5,6-tetrafluoroaniline has a molecular weight of 221.20 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2,3,5,6-tetrafluoroaniline is sourced from PubChem (CID 12566451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).