About 1,3,5-trifluoroadamantane
1,3,5-trifluoroadamantane (PubChem CID 12566525) has the molecular formula C10H13F3
and a molecular weight of 190.21 g/mol. Its IUPAC name is 1,3,5-trifluoroadamantane.
Molecular Properties
| Compound Name | 1,3,5-trifluoroadamantane |
| PubChem CID | 12566525 |
| Molecular Formula | C10H13F3 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1,3,5-trifluoroadamantane |
| SMILES | FC12CC3CC(F)(C1)CC(F)(C3)C2 |
| InChI | InChI=1S/C10H13F3/c11-8-1-7-2-9(12,4-8)6-10(13,3-7)5-8/h7H,1-6H2 |
| InChIKey | XYBQGLJTESAKPT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3,5-trifluoroadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trifluoroadamantane?
The IUPAC name of 1,3,5-trifluoroadamantane (CID 12566525) is 1,3,5-trifluoroadamantane.
What is the SMILES notation for 1,3,5-trifluoroadamantane?
The canonical SMILES for 1,3,5-trifluoroadamantane is FC12CC3CC(F)(C1)CC(F)(C3)C2.
What is the InChIKey of 1,3,5-trifluoroadamantane?
The InChIKey is XYBQGLJTESAKPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3/c11-8-1-7-2-9(12,4-8)6-10(13,3-7)5-8/h7H,1-6H2.
What are the key properties of 1,3,5-trifluoroadamantane?
1,3,5-trifluoroadamantane has a molecular weight of 190.21 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trifluoroadamantane is sourced from PubChem (CID 12566525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).