About 1,3,5,7-tetrafluoroadamantane
1,3,5,7-tetrafluoroadamantane (PubChem CID 12566526) has the molecular formula C10H12F4
and a molecular weight of 208.20 g/mol. Its IUPAC name is 1,3,5,7-tetrafluoroadamantane.
Molecular Properties
| Compound Name | 1,3,5,7-tetrafluoroadamantane |
| PubChem CID | 12566526 |
| Molecular Formula | C10H12F4 |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1,3,5,7-tetrafluoroadamantane |
| SMILES | FC12CC3(F)CC(F)(C1)CC(F)(C2)C3 |
| InChI | InChI=1S/C10H12F4/c11-7-1-8(12)4-9(13,2-7)6-10(14,3-7)5-8/h1-6H2 |
| InChIKey | BKNBEMOWTNIPTF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3,5,7-tetrafluoroadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5,7-tetrafluoroadamantane?
The IUPAC name of 1,3,5,7-tetrafluoroadamantane (CID 12566526) is 1,3,5,7-tetrafluoroadamantane.
What is the SMILES notation for 1,3,5,7-tetrafluoroadamantane?
The canonical SMILES for 1,3,5,7-tetrafluoroadamantane is FC12CC3(F)CC(F)(C1)CC(F)(C2)C3.
What is the InChIKey of 1,3,5,7-tetrafluoroadamantane?
The InChIKey is BKNBEMOWTNIPTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F4/c11-7-1-8(12)4-9(13,2-7)6-10(14,3-7)5-8/h1-6H2.
What are the key properties of 1,3,5,7-tetrafluoroadamantane?
1,3,5,7-tetrafluoroadamantane has a molecular weight of 208.20 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5,7-tetrafluoroadamantane is sourced from PubChem (CID 12566526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).