About 2-methyl-5-phenyl-1,2,4,3-triazaphosphole
2-methyl-5-phenyl-1,2,4,3-triazaphosphole (PubChem CID 12566595) has the molecular formula C8H8N3P
and a molecular weight of 177.15 g/mol. Its IUPAC name is 2-methyl-5-phenyl-1,2,4,3-triazaphosphole.
Molecular Properties
| Compound Name | 2-methyl-5-phenyl-1,2,4,3-triazaphosphole |
| PubChem CID | 12566595 |
| Molecular Formula | C8H8N3P |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-methyl-5-phenyl-1,2,4,3-triazaphosphole |
| SMILES | Cn1nc(-c2ccccc2)np1 |
| InChI | InChI=1S/C8H8N3P/c1-11-9-8(10-12-11)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | OVZRPSHWOBUROA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5-phenyl-1,2,4,3-triazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-phenyl-1,2,4,3-triazaphosphole?
The IUPAC name of 2-methyl-5-phenyl-1,2,4,3-triazaphosphole (CID 12566595) is 2-methyl-5-phenyl-1,2,4,3-triazaphosphole.
What is the SMILES notation for 2-methyl-5-phenyl-1,2,4,3-triazaphosphole?
The canonical SMILES for 2-methyl-5-phenyl-1,2,4,3-triazaphosphole is Cn1nc(-c2ccccc2)np1.
What is the InChIKey of 2-methyl-5-phenyl-1,2,4,3-triazaphosphole?
The InChIKey is OVZRPSHWOBUROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N3P/c1-11-9-8(10-12-11)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of 2-methyl-5-phenyl-1,2,4,3-triazaphosphole?
2-methyl-5-phenyl-1,2,4,3-triazaphosphole has a molecular weight of 177.15 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-phenyl-1,2,4,3-triazaphosphole is sourced from PubChem (CID 12566595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).