About triethyl-(3-methoxy-2,2-dimethylpropoxy)silane
triethyl-(3-methoxy-2,2-dimethylpropoxy)silane (PubChem CID 12566697) has the molecular formula C12H28O2Si
and a molecular weight of 232.44 g/mol. Its IUPAC name is triethyl-(3-methoxy-2,2-dimethylpropoxy)silane.
Molecular Properties
| Compound Name | triethyl-(3-methoxy-2,2-dimethylpropoxy)silane |
| PubChem CID | 12566697 |
| Molecular Formula | C12H28O2Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | triethyl-(3-methoxy-2,2-dimethylpropoxy)silane |
| SMILES | CC[Si](CC)(CC)OCC(C)(C)COC |
| InChI | InChI=1S/C12H28O2Si/c1-7-15(8-2,9-3)14-11-12(4,5)10-13-6/h7-11H2,1-6H3 |
| InChIKey | SYUMEVLWDLEJSA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-(3-methoxy-2,2-dimethylpropoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(3-methoxy-2,2-dimethylpropoxy)silane?
The IUPAC name of triethyl-(3-methoxy-2,2-dimethylpropoxy)silane (CID 12566697) is triethyl-(3-methoxy-2,2-dimethylpropoxy)silane.
What is the SMILES notation for triethyl-(3-methoxy-2,2-dimethylpropoxy)silane?
The canonical SMILES for triethyl-(3-methoxy-2,2-dimethylpropoxy)silane is CC[Si](CC)(CC)OCC(C)(C)COC.
What is the InChIKey of triethyl-(3-methoxy-2,2-dimethylpropoxy)silane?
The InChIKey is SYUMEVLWDLEJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O2Si/c1-7-15(8-2,9-3)14-11-12(4,5)10-13-6/h7-11H2,1-6H3.
What are the key properties of triethyl-(3-methoxy-2,2-dimethylpropoxy)silane?
triethyl-(3-methoxy-2,2-dimethylpropoxy)silane has a molecular weight of 232.44 g/mol, XLogP of 3.68, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(3-methoxy-2,2-dimethylpropoxy)silane is sourced from PubChem (CID 12566697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).