C9H5F5 — CID 12566938
[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]benzene (PubChem CID 12566938) has the molecular formula C9H5F5 and a molecular weight of 208.13 g/mol. Its IUPAC name is [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]benzene.
| Compound Name | [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 12566938 |
| Molecular Formula | C9H5F5 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]benzene |
| SMILES | F/C(=C(\F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H5F5/c10-7(8(11)9(12,13)14)6-4-2-1-3-5-6/h1-5H/b8-7- |
| InChIKey | KIWFVZHBXKNTGJ-FPLPWBNLSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |