About (5S)-5-methylhept-1-ene
(5S)-5-methylhept-1-ene (PubChem CID 12567238) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is (5S)-5-methylhept-1-ene.
Molecular Properties
| Compound Name | (5S)-5-methylhept-1-ene |
| PubChem CID | 12567238 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | (5S)-5-methylhept-1-ene |
| SMILES | C=CCC[C@@H](C)CC |
| InChI | InChI=1S/C8H16/c1-4-6-7-8(3)5-2/h4,8H,1,5-7H2,2-3H3/t8-/m0/s1 |
| InChIKey | WNEYWVBECXCQRT-QMMMGPOBSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-methylhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methylhept-1-ene?
The IUPAC name of (5S)-5-methylhept-1-ene (CID 12567238) is (5S)-5-methylhept-1-ene.
What is the SMILES notation for (5S)-5-methylhept-1-ene?
The canonical SMILES for (5S)-5-methylhept-1-ene is C=CCC[C@@H](C)CC.
What is the InChIKey of (5S)-5-methylhept-1-ene?
The InChIKey is WNEYWVBECXCQRT-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16/c1-4-6-7-8(3)5-2/h4,8H,1,5-7H2,2-3H3/t8-/m0/s1.
What are the key properties of (5S)-5-methylhept-1-ene?
(5S)-5-methylhept-1-ene has a molecular weight of 112.22 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methylhept-1-ene is sourced from PubChem (CID 12567238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).