About N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide
N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide (PubChem CID 1256753) has the molecular formula C23H21ClN2O3
and a molecular weight of 408.89 g/mol. Its IUPAC name is N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide.
Molecular Properties
| Compound Name | N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide |
| PubChem CID | 1256753 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide |
| SMILES | CC(=O)N(NC(=O)C(O)(c1ccccc1)c1ccccc1)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C23H21ClN2O3/c1-16-13-14-20(15-21(16)24)26(17(2)27)25-22(28)23(29,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,29H,1-2H3,(H,25,28) |
| InChIKey | PTZFFTLUTAIOIW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide?
The IUPAC name of N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide (CID 1256753) is N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide.
What is the SMILES notation for N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide?
The canonical SMILES for N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide is CC(=O)N(NC(=O)C(O)(c1ccccc1)c1ccccc1)c1ccc(C)c(Cl)c1.
What is the InChIKey of N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide?
The InChIKey is PTZFFTLUTAIOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN2O3/c1-16-13-14-20(15-21(16)24)26(17(2)27)25-22(28)23(29,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,29H,1-2H3,(H,25,28).
What are the key properties of N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide?
N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide has a molecular weight of 408.89 g/mol, XLogP of 3.97, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-N'-(3-chloro-4-methylphenyl)-2-hydroxy-2,2-diphenylacetohydrazide is sourced from PubChem (CID 1256753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).