About 1-cyclohexyl-2,2-dimethoxyethanone
1-cyclohexyl-2,2-dimethoxyethanone (PubChem CID 12567624) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-dimethoxyethanone.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,2-dimethoxyethanone |
| PubChem CID | 12567624 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1-cyclohexyl-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H18O3/c1-12-10(13-2)9(11)8-6-4-3-5-7-8/h8,10H,3-7H2,1-2H3 |
| InChIKey | JUIDPCJUZDBDQY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2,2-dimethoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,2-dimethoxyethanone?
The IUPAC name of 1-cyclohexyl-2,2-dimethoxyethanone (CID 12567624) is 1-cyclohexyl-2,2-dimethoxyethanone.
What is the SMILES notation for 1-cyclohexyl-2,2-dimethoxyethanone?
The canonical SMILES for 1-cyclohexyl-2,2-dimethoxyethanone is COC(OC)C(=O)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,2-dimethoxyethanone?
The InChIKey is JUIDPCJUZDBDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-12-10(13-2)9(11)8-6-4-3-5-7-8/h8,10H,3-7H2,1-2H3.
What are the key properties of 1-cyclohexyl-2,2-dimethoxyethanone?
1-cyclohexyl-2,2-dimethoxyethanone has a molecular weight of 186.25 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,2-dimethoxyethanone is sourced from PubChem (CID 12567624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).