About dimethyl (2S,3R)-oxirane-2,3-dicarboxylate
dimethyl (2S,3R)-oxirane-2,3-dicarboxylate (PubChem CID 12567700) has the molecular formula C6H8O5
and a molecular weight of 160.12 g/mol. Its IUPAC name is dimethyl (2S,3R)-oxirane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (2S,3R)-oxirane-2,3-dicarboxylate |
| PubChem CID | 12567700 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | dimethyl (2S,3R)-oxirane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1O[C@H]1C(=O)OC |
| InChI | InChI=1S/C6H8O5/c1-9-5(7)3-4(11-3)6(8)10-2/h3-4H,1-2H3/t3-,4+ |
| InChIKey | KAGHUYFLGPUYKE-ZXZARUISSA-N |
| XLogP | -0.90 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2S,3R)-oxirane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S,3R)-oxirane-2,3-dicarboxylate?
The IUPAC name of dimethyl (2S,3R)-oxirane-2,3-dicarboxylate (CID 12567700) is dimethyl (2S,3R)-oxirane-2,3-dicarboxylate.
What is the SMILES notation for dimethyl (2S,3R)-oxirane-2,3-dicarboxylate?
The canonical SMILES for dimethyl (2S,3R)-oxirane-2,3-dicarboxylate is COC(=O)[C@H]1O[C@H]1C(=O)OC.
What is the InChIKey of dimethyl (2S,3R)-oxirane-2,3-dicarboxylate?
The InChIKey is KAGHUYFLGPUYKE-ZXZARUISSA-N. The full InChI is InChI=1S/C6H8O5/c1-9-5(7)3-4(11-3)6(8)10-2/h3-4H,1-2H3/t3-,4+.
What are the key properties of dimethyl (2S,3R)-oxirane-2,3-dicarboxylate?
dimethyl (2S,3R)-oxirane-2,3-dicarboxylate has a molecular weight of 160.12 g/mol, XLogP of -0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S,3R)-oxirane-2,3-dicarboxylate is sourced from PubChem (CID 12567700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).