About hexan-2-yl 4-methylbenzenesulfonate
hexan-2-yl 4-methylbenzenesulfonate (PubChem CID 12568538) has the molecular formula C13H20O3S
and a molecular weight of 256.37 g/mol. Its IUPAC name is hexan-2-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | hexan-2-yl 4-methylbenzenesulfonate |
| PubChem CID | 12568538 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | hexan-2-yl 4-methylbenzenesulfonate |
| SMILES | CCCCC(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H20O3S/c1-4-5-6-12(3)16-17(14,15)13-9-7-11(2)8-10-13/h7-10,12H,4-6H2,1-3H3 |
| InChIKey | CCLUAVUSWKGWIJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze hexan-2-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-yl 4-methylbenzenesulfonate?
The IUPAC name of hexan-2-yl 4-methylbenzenesulfonate (CID 12568538) is hexan-2-yl 4-methylbenzenesulfonate.
What is the SMILES notation for hexan-2-yl 4-methylbenzenesulfonate?
The canonical SMILES for hexan-2-yl 4-methylbenzenesulfonate is CCCCC(C)OS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of hexan-2-yl 4-methylbenzenesulfonate?
The InChIKey is CCLUAVUSWKGWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S/c1-4-5-6-12(3)16-17(14,15)13-9-7-11(2)8-10-13/h7-10,12H,4-6H2,1-3H3.
What are the key properties of hexan-2-yl 4-methylbenzenesulfonate?
hexan-2-yl 4-methylbenzenesulfonate has a molecular weight of 256.37 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 12568538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).