About 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine
9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine (PubChem CID 1256854) has the molecular formula C20H16Cl2N4O
and a molecular weight of 399.28 g/mol. Its IUPAC name is 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine.
Molecular Properties
| Compound Name | 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine |
| PubChem CID | 1256854 |
| Molecular Formula | C20H16Cl2N4O |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine |
| SMILES | Cc1cc(C)cc(Oc2ncnc3c2ncn3Cc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O/c1-12-6-13(2)8-14(7-12)27-20-18-19(23-10-24-20)26(11-25-18)9-15-16(21)4-3-5-17(15)22/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | UHMUETSGGIRGON-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine?
The IUPAC name of 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine (CID 1256854) is 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine.
What is the SMILES notation for 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine?
The canonical SMILES for 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine is Cc1cc(C)cc(Oc2ncnc3c2ncn3Cc2c(Cl)cccc2Cl)c1.
What is the InChIKey of 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine?
The InChIKey is UHMUETSGGIRGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl2N4O/c1-12-6-13(2)8-14(7-12)27-20-18-19(23-10-24-20)26(11-25-18)9-15-16(21)4-3-5-17(15)22/h3-8,10-11H,9H2,1-2H3.
What are the key properties of 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine?
9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine has a molecular weight of 399.28 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-dichlorophenyl)methyl]-6-(3,5-dimethylphenoxy)purine is sourced from PubChem (CID 1256854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).