About 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 12568994) has the molecular formula C10H13N3O2S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 12568994 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(N2CCOCC2)nc2n1CCS2 |
| InChI | InChI=1S/C10H13N3O2S/c14-9-7-8(12-1-4-15-5-2-12)11-10-13(9)3-6-16-10/h7H,1-6H2 |
| InChIKey | MSNOXDRAMCMDNY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 12568994) is 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one is O=c1cc(N2CCOCC2)nc2n1CCS2.
What is the InChIKey of 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is MSNOXDRAMCMDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S/c14-9-7-8(12-1-4-15-5-2-12)11-10-13(9)3-6-16-10/h7H,1-6H2.
What are the key properties of 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 239.30 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-morpholin-4-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 12568994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).